About azulene;boric acid
azulene;boric acid (PubChem CID 175218967) has the molecular formula C10H20B4O12
and a molecular weight of 375.51 g/mol. Its IUPAC name is azulene;boric acid.
Molecular Properties
| Compound Name | azulene;boric acid |
| PubChem CID | 175218967 |
| Molecular Formula | C10H20B4O12 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | azulene;boric acid |
| SMILES | OB(O)O.OB(O)O.OB(O)O.OB(O)O.c1ccc2cccc-2cc1 |
| InChI | InChI=1S/C10H8.4BH3O3/c1-2-5-9-7-4-8-10(9)6-3-1;4*2-1(3)4/h1-8H;4*2-4H |
| InChIKey | GUGYIBRNBMFKQQ-UHFFFAOYSA-N |
| XLogP | -5.42 |
| TPSA | 242.76 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | -5.42 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azulene;boric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azulene;boric acid?
The IUPAC name of azulene;boric acid (CID 175218967) is azulene;boric acid.
What is the SMILES notation for azulene;boric acid?
The canonical SMILES for azulene;boric acid is OB(O)O.OB(O)O.OB(O)O.OB(O)O.c1ccc2cccc-2cc1.
What is the InChIKey of azulene;boric acid?
The InChIKey is GUGYIBRNBMFKQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.4BH3O3/c1-2-5-9-7-4-8-10(9)6-3-1;4*2-1(3)4/h1-8H;4*2-4H.
What are the key properties of azulene;boric acid?
azulene;boric acid has a molecular weight of 375.51 g/mol, XLogP of -5.42, 0 rotatable bonds, 12 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for azulene;boric acid is sourced from PubChem (CID 175218967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).