About boric acid;3-phenylaniline
boric acid;3-phenylaniline (PubChem CID 175929728) has the molecular formula C12H14BNO3
and a molecular weight of 231.06 g/mol. Its IUPAC name is boric acid;3-phenylaniline.
Molecular Properties
| Compound Name | boric acid;3-phenylaniline |
| PubChem CID | 175929728 |
| Molecular Formula | C12H14BNO3 |
| Molecular Weight | 231.06 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | boric acid;3-phenylaniline |
| SMILES | Nc1cccc(-c2ccccc2)c1.OB(O)O |
| InChI | InChI=1S/C12H11N.BH3O3/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;2-1(3)4/h1-9H,13H2;2-4H |
| InChIKey | NVVQPCOUTXSJRO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.06 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;3-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;3-phenylaniline?
The IUPAC name of boric acid;3-phenylaniline (CID 175929728) is boric acid;3-phenylaniline.
What is the SMILES notation for boric acid;3-phenylaniline?
The canonical SMILES for boric acid;3-phenylaniline is Nc1cccc(-c2ccccc2)c1.OB(O)O.
What is the InChIKey of boric acid;3-phenylaniline?
The InChIKey is NVVQPCOUTXSJRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.BH3O3/c13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;2-1(3)4/h1-9H,13H2;2-4H.
What are the key properties of boric acid;3-phenylaniline?
boric acid;3-phenylaniline has a molecular weight of 231.06 g/mol, XLogP of 0.88, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;3-phenylaniline is sourced from PubChem (CID 175929728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).