C23H16F3NO5 — CID 162538491
methyl 3-[2-nitro-3,4-diphenyl-6-(trifluoromethyl)phenyl]-2-oxopropanoate (PubChem CID 162538491) has the molecular formula C23H16F3NO5 and a molecular weight of 443.38 g/mol. Its IUPAC name is methyl 3-[2-nitro-3,4-diphenyl-6-(trifluoromethyl)phenyl]-2-oxopropanoate.
| Compound Name | methyl 3-[2-nitro-3,4-diphenyl-6-(trifluoromethyl)phenyl]-2-oxopropanoate |
|---|---|
| PubChem CID | 162538491 |
| Molecular Formula | C23H16F3NO5 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | methyl 3-[2-nitro-3,4-diphenyl-6-(trifluoromethyl)phenyl]-2-oxopropanoate |
| SMILES | COC(=O)C(=O)Cc1c(C(F)(F)F)cc(-c2ccccc2)c(-c2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H16F3NO5/c1-32-22(29)19(28)13-17-18(23(24,25)26)12-16(14-8-4-2-5-9-14)20(21(17)27(30)31)15-10-6-3-7-11-15/h2-12H,13H2,1H3 |
| InChIKey | AGFOXHVCKQCBKT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|