C18H17F3O4S — CID 87560501
2-[4-methoxy-2-(methylsulfinylmethyl)-3-phenyl-6-(trifluoromethyl)phenyl]acetic acid (PubChem CID 87560501) has the molecular formula C18H17F3O4S and a molecular weight of 386.39 g/mol. Its IUPAC name is 2-[4-methoxy-2-(methylsulfinylmethyl)-3-phenyl-6-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-[4-methoxy-2-(methylsulfinylmethyl)-3-phenyl-6-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 87560501 |
| Molecular Formula | C18H17F3O4S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-[4-methoxy-2-(methylsulfinylmethyl)-3-phenyl-6-(trifluoromethyl)phenyl]acetic acid |
| SMILES | COc1cc(C(F)(F)F)c(CC(=O)O)c(CS(C)=O)c1-c1ccccc1 |
| InChI | InChI=1S/C18H17F3O4S/c1-25-15-9-14(18(19,20)21)12(8-16(22)23)13(10-26(2)24)17(15)11-6-4-3-5-7-11/h3-7,9H,8,10H2,1-2H3,(H,22,23) |
| InChIKey | ZIPHUBDXUQVREO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |