C24H21F3O4S — CID 67432248
2-[3-[2-benzylsulfinyl-3-methyl-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetic acid (PubChem CID 67432248) has the molecular formula C24H21F3O4S and a molecular weight of 462.49 g/mol. Its IUPAC name is 2-[3-[2-benzylsulfinyl-3-methyl-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-[2-benzylsulfinyl-3-methyl-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 67432248 |
| Molecular Formula | C24H21F3O4S |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 2-[3-[2-benzylsulfinyl-3-methyl-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetic acid |
| SMILES | COc1ccc(CC(=O)O)cc1-c1ccc(C(F)(F)F)c(C)c1S(=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H21F3O4S/c1-15-20(24(25,26)27)10-9-18(23(15)32(30)14-16-6-4-3-5-7-16)19-12-17(13-22(28)29)8-11-21(19)31-2/h3-12H,13-14H2,1-2H3,(H,28,29) |
| InChIKey | SBLHNMLIAWZXKA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |