C27H29F3N2O4 — CID 143845580
2-[3-[2-[[[[benzyl(ethyl)amino]-hydroxymethyl]amino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetic acid (PubChem CID 143845580) has the molecular formula C27H29F3N2O4 and a molecular weight of 502.53 g/mol. Its IUPAC name is 2-[3-[2-[[[[benzyl(ethyl)amino]-hydroxymethyl]amino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-[2-[[[[benzyl(ethyl)amino]-hydroxymethyl]amino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 143845580 |
| Molecular Formula | C27H29F3N2O4 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 2-[3-[2-[[[[benzyl(ethyl)amino]-hydroxymethyl]amino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetic acid |
| SMILES | CCN(Cc1ccccc1)C(O)NCc1cc(C(F)(F)F)ccc1-c1cc(CC(=O)O)ccc1OC |
| InChI | InChI=1S/C27H29F3N2O4/c1-3-32(17-18-7-5-4-6-8-18)26(35)31-16-20-15-21(27(28,29)30)10-11-22(20)23-13-19(14-25(33)34)9-12-24(23)36-2/h4-13,15,26,31,35H,3,14,16-17H2,1-2H3,(H,33,34) |
| InChIKey | CMNMONGPDCQNHY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|