C27H28F3N2O4+ — CID 148811020
[2-[3-[2-[[benzylcarbamoyl(ethyl)amino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetyl]oxidanium (PubChem CID 148811020) has the molecular formula C27H28F3N2O4+ and a molecular weight of 501.53 g/mol. Its IUPAC name is [2-[3-[2-[[benzylcarbamoyl(ethyl)amino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetyl]oxidanium.
| Compound Name | [2-[3-[2-[[benzylcarbamoyl(ethyl)amino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetyl]oxidanium |
|---|---|
| PubChem CID | 148811020 |
| Molecular Formula | C27H28F3N2O4+ |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | [2-[3-[2-[[benzylcarbamoyl(ethyl)amino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetyl]oxidanium |
| SMILES | CCN(Cc1cc(C(F)(F)F)ccc1-c1cc(CC(=O)[OH2+])ccc1OC)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H27F3N2O4/c1-3-32(26(35)31-16-18-7-5-4-6-8-18)17-20-15-21(27(28,29)30)10-11-22(20)23-13-19(14-25(33)34)9-12-24(23)36-2/h4-13,15H,3,14,16-17H2,1-2H3,(H,31,35)(H,33,34)/p+1 |
| InChIKey | OPXIRFWNLBDKQB-UHFFFAOYSA-O |
| XLogP | 4.91 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|