C28H32N2O4 — CID 142785786
2-[3-[2-[[benzylcarbamoyl(ethyl)amino]methyl]-5-ethylphenyl]-4-methoxyphenyl]acetic acid (PubChem CID 142785786) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 2-[3-[2-[[benzylcarbamoyl(ethyl)amino]methyl]-5-ethylphenyl]-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-[2-[[benzylcarbamoyl(ethyl)amino]methyl]-5-ethylphenyl]-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 142785786 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 2-[3-[2-[[benzylcarbamoyl(ethyl)amino]methyl]-5-ethylphenyl]-4-methoxyphenyl]acetic acid |
| SMILES | CCc1ccc(CN(CC)C(=O)NCc2ccccc2)c(-c2cc(CC(=O)O)ccc2OC)c1 |
| InChI | InChI=1S/C28H32N2O4/c1-4-20-11-13-23(19-30(5-2)28(33)29-18-21-9-7-6-8-10-21)24(15-20)25-16-22(17-27(31)32)12-14-26(25)34-3/h6-16H,4-5,17-19H2,1-3H3,(H,29,33)(H,31,32) |
| InChIKey | DKQCAHWXANKUTE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |