C40H41F3N2O10 — CID 66607701
benzyl (2S,3S,4S,5R,6S)-6-[2-[3-[2-[[benzylcarbamoyl(ethyl)amino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 66607701) has the molecular formula C40H41F3N2O10 and a molecular weight of 766.77 g/mol. Its IUPAC name is benzyl (2S,3S,4S,5R,6S)-6-[2-[3-[2-[[benzylcarbamoyl(ethyl)amino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | benzyl (2S,3S,4S,5R,6S)-6-[2-[3-[2-[[benzylcarbamoyl(ethyl)amino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 66607701 |
| Molecular Formula | C40H41F3N2O10 |
| Molecular Weight | 766.77 g/mol |
| Exact Mass | 766.27 |
| IUPAC Name | benzyl (2S,3S,4S,5R,6S)-6-[2-[3-[2-[[benzylcarbamoyl(ethyl)amino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetyl]oxy-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | CCN(Cc1cc(C(F)(F)F)ccc1-c1cc(CC(=O)O[C@@H]2O[C@H](C(=O)OCc3ccccc3)[C@@H](O)[C@H](O)[C@H]2O)ccc1OC)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C40H41F3N2O10/c1-3-45(39(51)44-21-24-10-6-4-7-11-24)22-27-20-28(40(41,42)43)15-16-29(27)30-18-26(14-17-31(30)52-2)19-32(46)54-38-35(49)33(47)34(48)36(55-38)37(50)53-23-25-12-8-5-9-13-25/h4-18,20,33-36,38,47-49H,3,19,21-23H2,1-2H3,(H,44,51)/t33-,34-,35+,36-,38+/m0/s1 |
| InChIKey | ZLZOACUQPWKIJX-XAPMQAIDSA-N |
| XLogP | 4.75 |
| TPSA | 164.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.77 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |