C29H29F3N4O4 — CID 87071740
2-[3-[2-[[[N-cyano-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]-ethylamino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetic acid (PubChem CID 87071740) has the molecular formula C29H29F3N4O4 and a molecular weight of 554.57 g/mol. Its IUPAC name is 2-[3-[2-[[[N-cyano-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]-ethylamino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-[2-[[[N-cyano-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]-ethylamino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 87071740 |
| Molecular Formula | C29H29F3N4O4 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | 2-[3-[2-[[[N-cyano-N'-[(4-methoxyphenyl)methyl]carbamimidoyl]-ethylamino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetic acid |
| SMILES | CCN(Cc1cc(C(F)(F)F)ccc1-c1cc(CC(=O)O)ccc1OC)/C(=N/Cc1ccc(OC)cc1)NC#N |
| InChI | InChI=1S/C29H29F3N4O4/c1-4-36(28(35-18-33)34-16-19-5-9-23(39-2)10-6-19)17-21-15-22(29(30,31)32)8-11-24(21)25-13-20(14-27(37)38)7-12-26(25)40-3/h5-13,15H,4,14,16-17H2,1-3H3,(H,34,35)(H,37,38) |
| InChIKey | IQSYRUHCLUZTBP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|