C21H23F3O5S — CID 45280405
2-[3-[2-(tert-butylsulfonylmethyl)-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetic acid (PubChem CID 45280405) has the molecular formula C21H23F3O5S and a molecular weight of 444.47 g/mol. Its IUPAC name is 2-[3-[2-(tert-butylsulfonylmethyl)-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-[2-(tert-butylsulfonylmethyl)-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 45280405 |
| Molecular Formula | C21H23F3O5S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 2-[3-[2-(tert-butylsulfonylmethyl)-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetic acid |
| SMILES | COc1ccc(CC(=O)O)cc1-c1ccc(C(F)(F)F)cc1CS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C21H23F3O5S/c1-20(2,3)30(27,28)12-14-11-15(21(22,23)24)6-7-16(14)17-9-13(10-19(25)26)5-8-18(17)29-4/h5-9,11H,10,12H2,1-4H3,(H,25,26) |
| InChIKey | SVKCQOJPPGRPIN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |