C20H22F3NO3 — CID 162543583
methyl 2-[4-methoxy-3-[2-[1-(methylamino)ethyl]-4-(trifluoromethyl)phenyl]phenyl]acetate (PubChem CID 162543583) has the molecular formula C20H22F3NO3 and a molecular weight of 381.39 g/mol. Its IUPAC name is methyl 2-[4-methoxy-3-[2-[1-(methylamino)ethyl]-4-(trifluoromethyl)phenyl]phenyl]acetate.
| Compound Name | methyl 2-[4-methoxy-3-[2-[1-(methylamino)ethyl]-4-(trifluoromethyl)phenyl]phenyl]acetate |
|---|---|
| PubChem CID | 162543583 |
| Molecular Formula | C20H22F3NO3 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | methyl 2-[4-methoxy-3-[2-[1-(methylamino)ethyl]-4-(trifluoromethyl)phenyl]phenyl]acetate |
| SMILES | CNC(C)c1cc(C(F)(F)F)ccc1-c1cc(CC(=O)OC)ccc1OC |
| InChI | InChI=1S/C20H22F3NO3/c1-12(24-2)16-11-14(20(21,22)23)6-7-15(16)17-9-13(10-19(25)27-4)5-8-18(17)26-3/h5-9,11-12,24H,10H2,1-4H3 |
| InChIKey | UHQAXVMWXOSNFK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |