C21H27NO3 — CID 58148996
methyl 2-[3-[2-[1-(ethylamino)ethyl]-4-methylphenyl]-4-methoxyphenyl]acetate (PubChem CID 58148996) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is methyl 2-[3-[2-[1-(ethylamino)ethyl]-4-methylphenyl]-4-methoxyphenyl]acetate.
| Compound Name | methyl 2-[3-[2-[1-(ethylamino)ethyl]-4-methylphenyl]-4-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 58148996 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | methyl 2-[3-[2-[1-(ethylamino)ethyl]-4-methylphenyl]-4-methoxyphenyl]acetate |
| SMILES | CCNC(C)c1cc(C)ccc1-c1cc(CC(=O)OC)ccc1OC |
| InChI | InChI=1S/C21H27NO3/c1-6-22-15(3)18-11-14(2)7-9-17(18)19-12-16(13-21(23)25-5)8-10-20(19)24-4/h7-12,15,22H,6,13H2,1-5H3 |
| InChIKey | TVPMDHJASIXFFV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |