C25H26O4 — CID 58460068
ethyl 2-[4-methoxy-3-[4-methyl-2-(phenoxymethyl)phenyl]phenyl]acetate (PubChem CID 58460068) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is ethyl 2-[4-methoxy-3-[4-methyl-2-(phenoxymethyl)phenyl]phenyl]acetate.
| Compound Name | ethyl 2-[4-methoxy-3-[4-methyl-2-(phenoxymethyl)phenyl]phenyl]acetate |
|---|---|
| PubChem CID | 58460068 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | ethyl 2-[4-methoxy-3-[4-methyl-2-(phenoxymethyl)phenyl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(OC)c(-c2ccc(C)cc2COc2ccccc2)c1 |
| InChI | InChI=1S/C25H26O4/c1-4-28-25(26)16-19-11-13-24(27-3)23(15-19)22-12-10-18(2)14-20(22)17-29-21-8-6-5-7-9-21/h5-15H,4,16-17H2,1-3H3 |
| InChIKey | NKCYLOKZBCJTLK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |