C24H24O4S — CID 58460080
2-[3-[2-(benzylsulfinylmethyl)-4-methylphenyl]-4-methoxyphenyl]acetic acid (PubChem CID 58460080) has the molecular formula C24H24O4S and a molecular weight of 408.52 g/mol. Its IUPAC name is 2-[3-[2-(benzylsulfinylmethyl)-4-methylphenyl]-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-[2-(benzylsulfinylmethyl)-4-methylphenyl]-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 58460080 |
| Molecular Formula | C24H24O4S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 2-[3-[2-(benzylsulfinylmethyl)-4-methylphenyl]-4-methoxyphenyl]acetic acid |
| SMILES | COc1ccc(CC(=O)O)cc1-c1ccc(C)cc1CS(=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H24O4S/c1-17-8-10-21(22-13-19(14-24(25)26)9-11-23(22)28-2)20(12-17)16-29(27)15-18-6-4-3-5-7-18/h3-13H,14-16H2,1-2H3,(H,25,26) |
| InChIKey | LDJGUKZOWBLMJK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |