C23H29NO3 — CID 58149067
methyl 2-[3-[2-[(cyclopentylamino)methyl]-4-methylphenyl]-4-methoxyphenyl]acetate (PubChem CID 58149067) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is methyl 2-[3-[2-[(cyclopentylamino)methyl]-4-methylphenyl]-4-methoxyphenyl]acetate.
| Compound Name | methyl 2-[3-[2-[(cyclopentylamino)methyl]-4-methylphenyl]-4-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 58149067 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | methyl 2-[3-[2-[(cyclopentylamino)methyl]-4-methylphenyl]-4-methoxyphenyl]acetate |
| SMILES | COC(=O)Cc1ccc(OC)c(-c2ccc(C)cc2CNC2CCCC2)c1 |
| InChI | InChI=1S/C23H29NO3/c1-16-8-10-20(18(12-16)15-24-19-6-4-5-7-19)21-13-17(14-23(25)27-3)9-11-22(21)26-2/h8-13,19,24H,4-7,14-15H2,1-3H3 |
| InChIKey | XZSGPXBQMGVARV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |