C29H31NO8 — CID 118619870
benzyl 3-[[5-carboxyoxy-2-[5-(2-ethoxy-2-oxoethyl)-2-methoxyphenyl]phenyl]methylamino]propanoate (PubChem CID 118619870) has the molecular formula C29H31NO8 and a molecular weight of 521.57 g/mol. Its IUPAC name is benzyl 3-[[5-carboxyoxy-2-[5-(2-ethoxy-2-oxoethyl)-2-methoxyphenyl]phenyl]methylamino]propanoate.
| Compound Name | benzyl 3-[[5-carboxyoxy-2-[5-(2-ethoxy-2-oxoethyl)-2-methoxyphenyl]phenyl]methylamino]propanoate |
|---|---|
| PubChem CID | 118619870 |
| Molecular Formula | C29H31NO8 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | benzyl 3-[[5-carboxyoxy-2-[5-(2-ethoxy-2-oxoethyl)-2-methoxyphenyl]phenyl]methylamino]propanoate |
| SMILES | CCOC(=O)Cc1ccc(OC)c(-c2ccc(OC(=O)O)cc2CNCCC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C29H31NO8/c1-3-36-28(32)16-21-9-12-26(35-2)25(15-21)24-11-10-23(38-29(33)34)17-22(24)18-30-14-13-27(31)37-19-20-7-5-4-6-8-20/h4-12,15,17,30H,3,13-14,16,18-19H2,1-2H3,(H,33,34) |
| InChIKey | ZTXFDLWPRIFEGF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|