C30H32F3NO5 — CID 66606832
ethyl 2-[4-methoxy-3-[2-[[(3-oxo-3-phenylmethoxypropyl)amino]methyl]-4-(trifluoromethyl)phenyl]phenyl]propanoate (PubChem CID 66606832) has the molecular formula C30H32F3NO5 and a molecular weight of 543.58 g/mol. Its IUPAC name is ethyl 2-[4-methoxy-3-[2-[[(3-oxo-3-phenylmethoxypropyl)amino]methyl]-4-(trifluoromethyl)phenyl]phenyl]propanoate.
| Compound Name | ethyl 2-[4-methoxy-3-[2-[[(3-oxo-3-phenylmethoxypropyl)amino]methyl]-4-(trifluoromethyl)phenyl]phenyl]propanoate |
|---|---|
| PubChem CID | 66606832 |
| Molecular Formula | C30H32F3NO5 |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | ethyl 2-[4-methoxy-3-[2-[[(3-oxo-3-phenylmethoxypropyl)amino]methyl]-4-(trifluoromethyl)phenyl]phenyl]propanoate |
| SMILES | CCOC(=O)C(C)c1ccc(OC)c(-c2ccc(C(F)(F)F)cc2CNCCC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C30H32F3NO5/c1-4-38-29(36)20(2)22-10-13-27(37-3)26(17-22)25-12-11-24(30(31,32)33)16-23(25)18-34-15-14-28(35)39-19-21-8-6-5-7-9-21/h5-13,16-17,20,34H,4,14-15,18-19H2,1-3H3 |
| InChIKey | UERZLUQTQRPMFW-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|