C26H27NO5 — CID 68632775
2-[4-methoxy-3-[2-[[(3-oxo-3-phenylmethoxypropyl)amino]methyl]phenyl]phenyl]acetic acid (PubChem CID 68632775) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is 2-[4-methoxy-3-[2-[[(3-oxo-3-phenylmethoxypropyl)amino]methyl]phenyl]phenyl]acetic acid.
| Compound Name | 2-[4-methoxy-3-[2-[[(3-oxo-3-phenylmethoxypropyl)amino]methyl]phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 68632775 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 2-[4-methoxy-3-[2-[[(3-oxo-3-phenylmethoxypropyl)amino]methyl]phenyl]phenyl]acetic acid |
| SMILES | COc1ccc(CC(=O)O)cc1-c1ccccc1CNCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H27NO5/c1-31-24-12-11-20(16-25(28)29)15-23(24)22-10-6-5-9-21(22)17-27-14-13-26(30)32-18-19-7-3-2-4-8-19/h2-12,15,27H,13-14,16-18H2,1H3,(H,28,29) |
| InChIKey | LZNXAPBMAOCPMD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|