C29H32N2O5 — CID 66607898
2-[3-[2-[[(3-cyclopropyl-3-oxopropyl)amino]methyl]-4-(6-ethoxy-3-pyridinyl)phenyl]-4-methoxyphenyl]acetic acid (PubChem CID 66607898) has the molecular formula C29H32N2O5 and a molecular weight of 488.58 g/mol. Its IUPAC name is 2-[3-[2-[[(3-cyclopropyl-3-oxopropyl)amino]methyl]-4-(6-ethoxy-3-pyridinyl)phenyl]-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-[2-[[(3-cyclopropyl-3-oxopropyl)amino]methyl]-4-(6-ethoxy-3-pyridinyl)phenyl]-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 66607898 |
| Molecular Formula | C29H32N2O5 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 2-[3-[2-[[(3-cyclopropyl-3-oxopropyl)amino]methyl]-4-(6-ethoxy-3-pyridinyl)phenyl]-4-methoxyphenyl]acetic acid |
| SMILES | CCOc1ccc(-c2ccc(-c3cc(CC(=O)O)ccc3OC)c(CNCCC(=O)C3CC3)c2)cn1 |
| InChI | InChI=1S/C29H32N2O5/c1-3-36-28-11-8-22(18-31-28)21-7-9-24(23(16-21)17-30-13-12-26(32)20-5-6-20)25-14-19(15-29(33)34)4-10-27(25)35-2/h4,7-11,14,16,18,20,30H,3,5-6,12-13,15,17H2,1-2H3,(H,33,34) |
| InChIKey | FJKIJQOQGRALPA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|