C29H31FN2O4 — CID 66607227
ethyl 2-[3-[2-[[(3-cyclopropyl-3-oxopropyl)amino]methyl]-4-(5-fluoro-2-pyridinyl)phenyl]-4-methoxyphenyl]acetate (PubChem CID 66607227) has the molecular formula C29H31FN2O4 and a molecular weight of 490.58 g/mol. Its IUPAC name is ethyl 2-[3-[2-[[(3-cyclopropyl-3-oxopropyl)amino]methyl]-4-(5-fluoro-2-pyridinyl)phenyl]-4-methoxyphenyl]acetate.
| Compound Name | ethyl 2-[3-[2-[[(3-cyclopropyl-3-oxopropyl)amino]methyl]-4-(5-fluoro-2-pyridinyl)phenyl]-4-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 66607227 |
| Molecular Formula | C29H31FN2O4 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | ethyl 2-[3-[2-[[(3-cyclopropyl-3-oxopropyl)amino]methyl]-4-(5-fluoro-2-pyridinyl)phenyl]-4-methoxyphenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(OC)c(-c2ccc(-c3ccc(F)cn3)cc2CNCCC(=O)C2CC2)c1 |
| InChI | InChI=1S/C29H31FN2O4/c1-3-36-29(34)15-19-4-11-28(35-2)25(14-19)24-9-7-21(26-10-8-23(30)18-32-26)16-22(24)17-31-13-12-27(33)20-5-6-20/h4,7-11,14,16,18,20,31H,3,5-6,12-13,15,17H2,1-2H3 |
| InChIKey | BJBFWGZODZZXNH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|