C22H24FNO4 — CID 66604258
2-[3-[2-[[(3-cyclopropyl-3-oxopropyl)amino]methyl]-4-fluorophenyl]-4-methoxyphenyl]acetic acid (PubChem CID 66604258) has the molecular formula C22H24FNO4 and a molecular weight of 385.44 g/mol. Its IUPAC name is 2-[3-[2-[[(3-cyclopropyl-3-oxopropyl)amino]methyl]-4-fluorophenyl]-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-[2-[[(3-cyclopropyl-3-oxopropyl)amino]methyl]-4-fluorophenyl]-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 66604258 |
| Molecular Formula | C22H24FNO4 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-[3-[2-[[(3-cyclopropyl-3-oxopropyl)amino]methyl]-4-fluorophenyl]-4-methoxyphenyl]acetic acid |
| SMILES | COc1ccc(CC(=O)O)cc1-c1ccc(F)cc1CNCCC(=O)C1CC1 |
| InChI | InChI=1S/C22H24FNO4/c1-28-21-7-2-14(11-22(26)27)10-19(21)18-6-5-17(23)12-16(18)13-24-9-8-20(25)15-3-4-15/h2,5-7,10,12,15,24H,3-4,8-9,11,13H2,1H3,(H,26,27) |
| InChIKey | QREIEFLFVRXXDQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|