C25H28F3NO4 — CID 68639862
ethyl 2-[3-[2-[[(3-cyclopropyl-3-oxopropyl)amino]methyl]phenyl]-4-methoxy-5-(trifluoromethyl)phenyl]acetate (PubChem CID 68639862) has the molecular formula C25H28F3NO4 and a molecular weight of 463.50 g/mol. Its IUPAC name is ethyl 2-[3-[2-[[(3-cyclopropyl-3-oxopropyl)amino]methyl]phenyl]-4-methoxy-5-(trifluoromethyl)phenyl]acetate.
| Compound Name | ethyl 2-[3-[2-[[(3-cyclopropyl-3-oxopropyl)amino]methyl]phenyl]-4-methoxy-5-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 68639862 |
| Molecular Formula | C25H28F3NO4 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | ethyl 2-[3-[2-[[(3-cyclopropyl-3-oxopropyl)amino]methyl]phenyl]-4-methoxy-5-(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(-c2ccccc2CNCCC(=O)C2CC2)c(OC)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H28F3NO4/c1-3-33-23(31)14-16-12-20(24(32-2)21(13-16)25(26,27)28)19-7-5-4-6-18(19)15-29-11-10-22(30)17-8-9-17/h4-7,12-13,17,29H,3,8-11,14-15H2,1-2H3 |
| InChIKey | UKCXCRFTKDAEPZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|