C25H25NO5 — CID 58149023
ethyl 2-[3-[4-(6-ethoxy-3-pyridinyl)-2-formylphenyl]-4-methoxyphenyl]acetate (PubChem CID 58149023) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is ethyl 2-[3-[4-(6-ethoxy-3-pyridinyl)-2-formylphenyl]-4-methoxyphenyl]acetate.
| Compound Name | ethyl 2-[3-[4-(6-ethoxy-3-pyridinyl)-2-formylphenyl]-4-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 58149023 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | ethyl 2-[3-[4-(6-ethoxy-3-pyridinyl)-2-formylphenyl]-4-methoxyphenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(OC)c(-c2ccc(-c3ccc(OCC)nc3)cc2C=O)c1 |
| InChI | InChI=1S/C25H25NO5/c1-4-30-24-11-8-19(15-26-24)18-7-9-21(20(14-18)16-27)22-12-17(6-10-23(22)29-3)13-25(28)31-5-2/h6-12,14-16H,4-5,13H2,1-3H3 |
| InChIKey | VUBXRYJEFYWEBB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|