C33H30F3NO5 — CID 66605529
2-[3-[2-[[(3-oxo-3-phenylmethoxypropyl)amino]methyl]-4-(trifluoromethyl)phenyl]-4-phenylmethoxyphenyl]acetic acid (PubChem CID 66605529) has the molecular formula C33H30F3NO5 and a molecular weight of 577.60 g/mol. Its IUPAC name is 2-[3-[2-[[(3-oxo-3-phenylmethoxypropyl)amino]methyl]-4-(trifluoromethyl)phenyl]-4-phenylmethoxyphenyl]acetic acid.
| Compound Name | 2-[3-[2-[[(3-oxo-3-phenylmethoxypropyl)amino]methyl]-4-(trifluoromethyl)phenyl]-4-phenylmethoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 66605529 |
| Molecular Formula | C33H30F3NO5 |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | 2-[3-[2-[[(3-oxo-3-phenylmethoxypropyl)amino]methyl]-4-(trifluoromethyl)phenyl]-4-phenylmethoxyphenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(OCc2ccccc2)c(-c2ccc(C(F)(F)F)cc2CNCCC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C33H30F3NO5/c34-33(35,36)27-12-13-28(26(19-27)20-37-16-15-32(40)42-22-24-9-5-2-6-10-24)29-17-25(18-31(38)39)11-14-30(29)41-21-23-7-3-1-4-8-23/h1-14,17,19,37H,15-16,18,20-22H2,(H,38,39) |
| InChIKey | YQGMVBGNICZGTJ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|