C29H30F3NO5 — CID 142785877
2-[2-ethoxy-5-[2-[2-[(3-oxo-3-phenylmethoxypropyl)amino]ethyl]-4-(trifluoromethyl)phenyl]phenyl]acetic acid (PubChem CID 142785877) has the molecular formula C29H30F3NO5 and a molecular weight of 529.56 g/mol. Its IUPAC name is 2-[2-ethoxy-5-[2-[2-[(3-oxo-3-phenylmethoxypropyl)amino]ethyl]-4-(trifluoromethyl)phenyl]phenyl]acetic acid.
| Compound Name | 2-[2-ethoxy-5-[2-[2-[(3-oxo-3-phenylmethoxypropyl)amino]ethyl]-4-(trifluoromethyl)phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 142785877 |
| Molecular Formula | C29H30F3NO5 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 2-[2-ethoxy-5-[2-[2-[(3-oxo-3-phenylmethoxypropyl)amino]ethyl]-4-(trifluoromethyl)phenyl]phenyl]acetic acid |
| SMILES | CCOc1ccc(-c2ccc(C(F)(F)F)cc2CCNCCC(=O)OCc2ccccc2)cc1CC(=O)O |
| InChI | InChI=1S/C29H30F3NO5/c1-2-37-26-11-8-21(16-23(26)18-27(34)35)25-10-9-24(29(30,31)32)17-22(25)12-14-33-15-13-28(36)38-19-20-6-4-3-5-7-20/h3-11,16-17,33H,2,12-15,18-19H2,1H3,(H,34,35) |
| InChIKey | NPLJDWIZWPULLS-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|