C26H23F4NO4 — CID 66607864
2-[2-fluoro-5-[2-[[(3-oxo-3-phenylmethoxypropyl)amino]methyl]-4-(trifluoromethyl)phenyl]phenyl]acetic acid (PubChem CID 66607864) has the molecular formula C26H23F4NO4 and a molecular weight of 489.47 g/mol. Its IUPAC name is 2-[2-fluoro-5-[2-[[(3-oxo-3-phenylmethoxypropyl)amino]methyl]-4-(trifluoromethyl)phenyl]phenyl]acetic acid.
| Compound Name | 2-[2-fluoro-5-[2-[[(3-oxo-3-phenylmethoxypropyl)amino]methyl]-4-(trifluoromethyl)phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 66607864 |
| Molecular Formula | C26H23F4NO4 |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 2-[2-fluoro-5-[2-[[(3-oxo-3-phenylmethoxypropyl)amino]methyl]-4-(trifluoromethyl)phenyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(-c2ccc(C(F)(F)F)cc2CNCCC(=O)OCc2ccccc2)ccc1F |
| InChI | InChI=1S/C26H23F4NO4/c27-23-9-6-18(12-19(23)14-24(32)33)22-8-7-21(26(28,29)30)13-20(22)15-31-11-10-25(34)35-16-17-4-2-1-3-5-17/h1-9,12-13,31H,10-11,14-16H2,(H,32,33) |
| InChIKey | BMJNPTKBFBPLIE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|