C24H28F3NO4 — CID 142785861
2-[4-methoxy-3-[2-[(3-oxobutylamino)methyl]-4-(trifluoromethyl)phenyl]phenyl]-2-methylbutanoic acid (PubChem CID 142785861) has the molecular formula C24H28F3NO4 and a molecular weight of 451.49 g/mol. Its IUPAC name is 2-[4-methoxy-3-[2-[(3-oxobutylamino)methyl]-4-(trifluoromethyl)phenyl]phenyl]-2-methylbutanoic acid.
| Compound Name | 2-[4-methoxy-3-[2-[(3-oxobutylamino)methyl]-4-(trifluoromethyl)phenyl]phenyl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 142785861 |
| Molecular Formula | C24H28F3NO4 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 2-[4-methoxy-3-[2-[(3-oxobutylamino)methyl]-4-(trifluoromethyl)phenyl]phenyl]-2-methylbutanoic acid |
| SMILES | CCC(C)(C(=O)O)c1ccc(OC)c(-c2ccc(C(F)(F)F)cc2CNCCC(C)=O)c1 |
| InChI | InChI=1S/C24H28F3NO4/c1-5-23(3,22(30)31)17-7-9-21(32-4)20(13-17)19-8-6-18(24(25,26)27)12-16(19)14-28-11-10-15(2)29/h6-9,12-13,28H,5,10-11,14H2,1-4H3,(H,30,31) |
| InChIKey | HEWRAGBKHNUPFN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|