C20H22F3NO3 — CID 150996370
[[2-(2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]methylamino] acetate (PubChem CID 150996370) has the molecular formula C20H22F3NO3 and a molecular weight of 381.39 g/mol. Its IUPAC name is [[2-(2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]methylamino] acetate.
| Compound Name | [[2-(2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]methylamino] acetate |
|---|---|
| PubChem CID | 150996370 |
| Molecular Formula | C20H22F3NO3 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | [[2-(2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]methylamino] acetate |
| SMILES | COc1ccc(C(C)C)cc1-c1ccc(C(F)(F)F)cc1CNOC(C)=O |
| InChI | InChI=1S/C20H22F3NO3/c1-12(2)14-5-8-19(26-4)18(10-14)17-7-6-16(20(21,22)23)9-15(17)11-24-27-13(3)25/h5-10,12,24H,11H2,1-4H3 |
| InChIKey | LTEIZKMKCJVVDN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|