C28H23F9N2O — CID 86626887
[3,5-bis(trifluoromethyl)phenyl]methyl-[[2-(2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]methyl]cyanamide (PubChem CID 86626887) has the molecular formula C28H23F9N2O and a molecular weight of 574.49 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl-[[2-(2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]methyl]cyanamide.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl-[[2-(2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]methyl]cyanamide |
|---|---|
| PubChem CID | 86626887 |
| Molecular Formula | C28H23F9N2O |
| Molecular Weight | 574.49 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl-[[2-(2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]methyl]cyanamide |
| SMILES | COc1ccc(C(C)C)cc1-c1ccc(C(F)(F)F)cc1CN(C#N)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H23F9N2O/c1-16(2)18-4-7-25(40-3)24(11-18)23-6-5-20(26(29,30)31)10-19(23)14-39(15-38)13-17-8-21(27(32,33)34)12-22(9-17)28(35,36)37/h4-12,16H,13-14H2,1-3H3 |
| InChIKey | JSNSTVUOAXSXDA-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.49 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|