C26H28F3N2O4+ — CID 67950918
methyl N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-N-[[2-(2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 67950918) has the molecular formula C26H28F3N2O4+ and a molecular weight of 489.51 g/mol. Its IUPAC name is methyl N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-N-[[2-(2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | methyl N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-N-[[2-(2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 67950918 |
| Molecular Formula | C26H28F3N2O4+ |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | methyl N-[(1-hydroxypyridin-1-ium-3-yl)methyl]-N-[[2-(2-methoxy-5-propan-2-ylphenyl)-5-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | COC(=O)N(Cc1ccc[n+](O)c1)Cc1cc(C(F)(F)F)ccc1-c1cc(C(C)C)ccc1OC |
| InChI | InChI=1S/C26H28F3N2O4/c1-17(2)19-7-10-24(34-3)23(13-19)22-9-8-21(26(27,28)29)12-20(22)16-30(25(32)35-4)14-18-6-5-11-31(33)15-18/h5-13,15,17,33H,14,16H2,1-4H3/q+1 |
| InChIKey | CJYVCMQACLYWIJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|