C27H32F3N5O3 — CID 118630215
ethyl 2-[3-[2-[[[N-amino-N'-cyano-N-(cyclopropylmethyl)carbamimidoyl]-ethylamino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetate (PubChem CID 118630215) has the molecular formula C27H32F3N5O3 and a molecular weight of 531.58 g/mol. Its IUPAC name is ethyl 2-[3-[2-[[[N-amino-N'-cyano-N-(cyclopropylmethyl)carbamimidoyl]-ethylamino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetate.
| Compound Name | ethyl 2-[3-[2-[[[N-amino-N'-cyano-N-(cyclopropylmethyl)carbamimidoyl]-ethylamino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 118630215 |
| Molecular Formula | C27H32F3N5O3 |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | ethyl 2-[3-[2-[[[N-amino-N'-cyano-N-(cyclopropylmethyl)carbamimidoyl]-ethylamino]methyl]-4-(trifluoromethyl)phenyl]-4-methoxyphenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(OC)c(-c2ccc(C(F)(F)F)cc2CN(CC)/C(=N/C#N)N(N)CC2CC2)c1 |
| InChI | InChI=1S/C27H32F3N5O3/c1-4-34(26(33-17-31)35(32)15-18-6-7-18)16-20-14-21(27(28,29)30)9-10-22(20)23-12-19(8-11-24(23)37-3)13-25(36)38-5-2/h8-12,14,18H,4-7,13,15-16,32H2,1-3H3/b33-26- |
| InChIKey | HKLYEXINRINEHG-MKFPQRGTSA-N |
| XLogP | 4.73 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|