About ethane;methyl 3-(4-chloro-2-methyl-6-nitrophenyl)-2-oxopropanoate
ethane;methyl 3-(4-chloro-2-methyl-6-nitrophenyl)-2-oxopropanoate (PubChem CID 142017740) has the molecular formula C13H16ClNO5
and a molecular weight of 301.73 g/mol. Its IUPAC name is ethane;methyl 3-(4-chloro-2-methyl-6-nitrophenyl)-2-oxopropanoate.
Molecular Properties
| Compound Name | ethane;methyl 3-(4-chloro-2-methyl-6-nitrophenyl)-2-oxopropanoate |
| PubChem CID | 142017740 |
| Molecular Formula | C13H16ClNO5 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | ethane;methyl 3-(4-chloro-2-methyl-6-nitrophenyl)-2-oxopropanoate |
| SMILES | CC.COC(=O)C(=O)Cc1c(C)cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10ClNO5.C2H6/c1-6-3-7(12)4-9(13(16)17)8(6)5-10(14)11(15)18-2;1-2/h3-4H,5H2,1-2H3;1-2H3 |
| InChIKey | IRPVKOPCRBECDS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl 3-(4-chloro-2-methyl-6-nitrophenyl)-2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 3-(4-chloro-2-methyl-6-nitrophenyl)-2-oxopropanoate?
The IUPAC name of ethane;methyl 3-(4-chloro-2-methyl-6-nitrophenyl)-2-oxopropanoate (CID 142017740) is ethane;methyl 3-(4-chloro-2-methyl-6-nitrophenyl)-2-oxopropanoate.
What is the SMILES notation for ethane;methyl 3-(4-chloro-2-methyl-6-nitrophenyl)-2-oxopropanoate?
The canonical SMILES for ethane;methyl 3-(4-chloro-2-methyl-6-nitrophenyl)-2-oxopropanoate is CC.COC(=O)C(=O)Cc1c(C)cc(Cl)cc1[N+](=O)[O-].
What is the InChIKey of ethane;methyl 3-(4-chloro-2-methyl-6-nitrophenyl)-2-oxopropanoate?
The InChIKey is IRPVKOPCRBECDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO5.C2H6/c1-6-3-7(12)4-9(13(16)17)8(6)5-10(14)11(15)18-2;1-2/h3-4H,5H2,1-2H3;1-2H3.
What are the key properties of ethane;methyl 3-(4-chloro-2-methyl-6-nitrophenyl)-2-oxopropanoate?
ethane;methyl 3-(4-chloro-2-methyl-6-nitrophenyl)-2-oxopropanoate has a molecular weight of 301.73 g/mol, XLogP of 2.87, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 3-(4-chloro-2-methyl-6-nitrophenyl)-2-oxopropanoate is sourced from PubChem (CID 142017740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).