C10H8Cl3NO4 — CID 83193867
methyl 2-chloro-3-(2,4-dichloro-6-nitrophenyl)propanoate (PubChem CID 83193867) has the molecular formula C10H8Cl3NO4 and a molecular weight of 312.54 g/mol. Its IUPAC name is methyl 2-chloro-3-(2,4-dichloro-6-nitrophenyl)propanoate.
| Compound Name | methyl 2-chloro-3-(2,4-dichloro-6-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 83193867 |
| Molecular Formula | C10H8Cl3NO4 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 310.95 |
| IUPAC Name | methyl 2-chloro-3-(2,4-dichloro-6-nitrophenyl)propanoate |
| SMILES | COC(=O)C(Cl)Cc1c(Cl)cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8Cl3NO4/c1-18-10(15)8(13)4-6-7(12)2-5(11)3-9(6)14(16)17/h2-3,8H,4H2,1H3 |
| InChIKey | WMBNZPYDEKDUEB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|