C8H5Cl2NO5 — CID 54049022
(2,4-dichloro-6-nitrophenyl)methyl hydrogen carbonate (PubChem CID 54049022) has the molecular formula C8H5Cl2NO5 and a molecular weight of 266.04 g/mol. Its IUPAC name is (2,4-dichloro-6-nitrophenyl)methyl hydrogen carbonate.
| Compound Name | (2,4-dichloro-6-nitrophenyl)methyl hydrogen carbonate |
|---|---|
| PubChem CID | 54049022 |
| Molecular Formula | C8H5Cl2NO5 |
| Molecular Weight | 266.04 g/mol |
| Exact Mass | 264.95 |
| IUPAC Name | (2,4-dichloro-6-nitrophenyl)methyl hydrogen carbonate |
| SMILES | O=C(O)OCc1c(Cl)cc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5Cl2NO5/c9-4-1-6(10)5(3-16-8(12)13)7(2-4)11(14)15/h1-2H,3H2,(H,12,13) |
| InChIKey | LROOZWKRNYNTQX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.04 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|