C30H22O4 — CID 158101675
4,6-bis(4-hydroxyphenyl)-2,5-diphenylbenzene-1,3-diol (PubChem CID 158101675) has the molecular formula C30H22O4 and a molecular weight of 446.50 g/mol. Its IUPAC name is 4,6-bis(4-hydroxyphenyl)-2,5-diphenylbenzene-1,3-diol.
| Compound Name | 4,6-bis(4-hydroxyphenyl)-2,5-diphenylbenzene-1,3-diol |
|---|---|
| PubChem CID | 158101675 |
| Molecular Formula | C30H22O4 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 4,6-bis(4-hydroxyphenyl)-2,5-diphenylbenzene-1,3-diol |
| SMILES | Oc1ccc(-c2c(O)c(-c3ccccc3)c(O)c(-c3ccc(O)cc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H22O4/c31-23-15-11-21(12-16-23)26-25(19-7-3-1-4-8-19)27(22-13-17-24(32)18-14-22)30(34)28(29(26)33)20-9-5-2-6-10-20/h1-18,31-34H |
| InChIKey | FPILXQJNFGSCAO-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |