C38H26O4 — CID 54527880
4-[2,3,4-tris(4-hydroxyphenyl)anthracen-1-yl]phenol (PubChem CID 54527880) has the molecular formula C38H26O4 and a molecular weight of 546.62 g/mol. Its IUPAC name is 4-[2,3,4-tris(4-hydroxyphenyl)anthracen-1-yl]phenol.
| Compound Name | 4-[2,3,4-tris(4-hydroxyphenyl)anthracen-1-yl]phenol |
|---|---|
| PubChem CID | 54527880 |
| Molecular Formula | C38H26O4 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | 4-[2,3,4-tris(4-hydroxyphenyl)anthracen-1-yl]phenol |
| SMILES | Oc1ccc(-c2c(-c3ccc(O)cc3)c(-c3ccc(O)cc3)c3cc4ccccc4cc3c2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C38H26O4/c39-29-13-5-23(6-14-29)35-33-21-27-3-1-2-4-28(27)22-34(33)36(24-7-15-30(40)16-8-24)38(26-11-19-32(42)20-12-26)37(35)25-9-17-31(41)18-10-25/h1-22,39-42H |
| InChIKey | YUJUNZZUQMRFRN-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|