C50H50 — CID 174880220
1,2,3,4-tetrakis(4-propan-2-ylphenyl)anthracene (PubChem CID 174880220) has the molecular formula C50H50 and a molecular weight of 650.95 g/mol. Its IUPAC name is 1,2,3,4-tetrakis(4-propan-2-ylphenyl)anthracene.
| Compound Name | 1,2,3,4-tetrakis(4-propan-2-ylphenyl)anthracene |
|---|---|
| PubChem CID | 174880220 |
| Molecular Formula | C50H50 |
| Molecular Weight | 650.95 g/mol |
| Exact Mass | 650.39 |
| IUPAC Name | 1,2,3,4-tetrakis(4-propan-2-ylphenyl)anthracene |
| SMILES | CC(C)c1ccc(-c2c(-c3ccc(C(C)C)cc3)c(-c3ccc(C(C)C)cc3)c3cc4ccccc4cc3c2-c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C50H50/c1-31(2)35-13-21-39(22-14-35)47-45-29-43-11-9-10-12-44(43)30-46(45)48(40-23-15-36(16-24-40)32(3)4)50(42-27-19-38(20-28-42)34(7)8)49(47)41-25-17-37(18-26-41)33(5)6/h9-34H,1-8H3 |
| InChIKey | OIWFBZYTCSNPOA-UHFFFAOYSA-N |
| XLogP | 15.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.95 |
| LogP ≤ 5 | 15.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|