C34H22O4 — CID 102071732
5-[13-(3,5-dihydroxyphenyl)pentacen-6-yl]benzene-1,3-diol (PubChem CID 102071732) has the molecular formula C34H22O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is 5-[13-(3,5-dihydroxyphenyl)pentacen-6-yl]benzene-1,3-diol.
| Compound Name | 5-[13-(3,5-dihydroxyphenyl)pentacen-6-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 102071732 |
| Molecular Formula | C34H22O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 5-[13-(3,5-dihydroxyphenyl)pentacen-6-yl]benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(-c2c3cc4ccccc4cc3c(-c3cc(O)cc(O)c3)c3cc4ccccc4cc23)c1 |
| InChI | InChI=1S/C34H22O4/c35-25-9-23(10-26(36)17-25)33-29-13-19-5-1-2-6-20(19)14-30(29)34(24-11-27(37)18-28(38)12-24)32-16-22-8-4-3-7-21(22)15-31(32)33/h1-18,35-38H |
| InChIKey | DYKNJKWREGPPBK-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|