C26H18O4 — CID 11047500
5-[10-(3,5-dihydroxyphenyl)anthracen-9-yl]benzene-1,3-diol (PubChem CID 11047500) has the molecular formula C26H18O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 5-[10-(3,5-dihydroxyphenyl)anthracen-9-yl]benzene-1,3-diol.
| Compound Name | 5-[10-(3,5-dihydroxyphenyl)anthracen-9-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 11047500 |
| Molecular Formula | C26H18O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 5-[10-(3,5-dihydroxyphenyl)anthracen-9-yl]benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(-c2c3ccccc3c(-c3cc(O)cc(O)c3)c3ccccc23)c1 |
| InChI | InChI=1S/C26H18O4/c27-17-9-15(10-18(28)13-17)25-21-5-1-2-6-22(21)26(24-8-4-3-7-23(24)25)16-11-19(29)14-20(30)12-16/h1-14,27-30H |
| InChIKey | BTBBWVMITMIXSY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|