C6H6N4O5 — CID 4122102
N-(3-amino-2,4-dinitrophenyl)hydroxylamine (PubChem CID 4122102) has the molecular formula C6H6N4O5 and a molecular weight of 214.14 g/mol. Its IUPAC name is N-(3-amino-2,4-dinitrophenyl)hydroxylamine.
| Compound Name | N-(3-amino-2,4-dinitrophenyl)hydroxylamine |
|---|---|
| PubChem CID | 4122102 |
| Molecular Formula | C6H6N4O5 |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | N-(3-amino-2,4-dinitrophenyl)hydroxylamine |
| SMILES | Nc1c([N+](=O)[O-])ccc(NO)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H6N4O5/c7-5-4(9(12)13)2-1-3(8-11)6(5)10(14)15/h1-2,8,11H,7H2 |
| InChIKey | SALJCBHHPYXCHX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 144.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|