C22H14N8O12 — CID 90467879
3-[(E)-2-[4-[(E)-2-(3-amino-2,4,6-trinitrophenyl)ethenyl]phenyl]ethenyl]-2,4,6-trinitroaniline (PubChem CID 90467879) has the molecular formula C22H14N8O12 and a molecular weight of 582.40 g/mol. Its IUPAC name is 3-[(E)-2-[4-[(E)-2-(3-amino-2,4,6-trinitrophenyl)ethenyl]phenyl]ethenyl]-2,4,6-trinitroaniline.
| Compound Name | 3-[(E)-2-[4-[(E)-2-(3-amino-2,4,6-trinitrophenyl)ethenyl]phenyl]ethenyl]-2,4,6-trinitroaniline |
|---|---|
| PubChem CID | 90467879 |
| Molecular Formula | C22H14N8O12 |
| Molecular Weight | 582.40 g/mol |
| Exact Mass | 582.07 |
| IUPAC Name | 3-[(E)-2-[4-[(E)-2-(3-amino-2,4,6-trinitrophenyl)ethenyl]phenyl]ethenyl]-2,4,6-trinitroaniline |
| SMILES | Nc1c([N+](=O)[O-])cc([N+](=O)[O-])c(/C=C/c2ccc(/C=C/c3c([N+](=O)[O-])cc([N+](=O)[O-])c(N)c3[N+](=O)[O-])cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H14N8O12/c23-19-17(27(35)36)9-15(25(31)32)13(21(19)29(39)40)7-5-11-1-2-12(4-3-11)6-8-14-16(26(33)34)10-18(28(37)38)20(24)22(14)30(41)42/h1-10H,23-24H2/b7-5+,8-6+ |
| InChIKey | OUSBROBNJPITGE-KQQUZDAGSA-N |
| XLogP | 4.64 |
| TPSA | 310.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|