C14H9ClN4O6 — CID 141339597
3-[2-(2-chlorophenyl)ethenyl]-2,4,6-trinitroaniline (PubChem CID 141339597) has the molecular formula C14H9ClN4O6 and a molecular weight of 364.70 g/mol. Its IUPAC name is 3-[2-(2-chlorophenyl)ethenyl]-2,4,6-trinitroaniline.
| Compound Name | 3-[2-(2-chlorophenyl)ethenyl]-2,4,6-trinitroaniline |
|---|---|
| PubChem CID | 141339597 |
| Molecular Formula | C14H9ClN4O6 |
| Molecular Weight | 364.70 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 3-[2-(2-chlorophenyl)ethenyl]-2,4,6-trinitroaniline |
| SMILES | Nc1c([N+](=O)[O-])cc([N+](=O)[O-])c(C=Cc2ccccc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H9ClN4O6/c15-10-4-2-1-3-8(10)5-6-9-11(17(20)21)7-12(18(22)23)13(16)14(9)19(24)25/h1-7H,16H2 |
| InChIKey | BPJIMCOJQKZNMI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 155.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.70 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|