C22H11Cl4N3O6 — CID 141365640
2,4-bis[2-(2,4-dichlorophenyl)ethenyl]-1,3,5-trinitrobenzene (PubChem CID 141365640) has the molecular formula C22H11Cl4N3O6 and a molecular weight of 555.16 g/mol. Its IUPAC name is 2,4-bis[2-(2,4-dichlorophenyl)ethenyl]-1,3,5-trinitrobenzene.
| Compound Name | 2,4-bis[2-(2,4-dichlorophenyl)ethenyl]-1,3,5-trinitrobenzene |
|---|---|
| PubChem CID | 141365640 |
| Molecular Formula | C22H11Cl4N3O6 |
| Molecular Weight | 555.16 g/mol |
| Exact Mass | 552.94 |
| IUPAC Name | 2,4-bis[2-(2,4-dichlorophenyl)ethenyl]-1,3,5-trinitrobenzene |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(C=Cc2ccc(Cl)cc2Cl)c([N+](=O)[O-])c1C=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H11Cl4N3O6/c23-14-5-1-12(18(25)9-14)3-7-16-20(27(30)31)11-21(28(32)33)17(22(16)29(34)35)8-4-13-2-6-15(24)10-19(13)26/h1-11H |
| InChIKey | QUCPQQADNSTPIY-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.16 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|