About 5-[2-(4-hydroxyphenyl)ethenyl]-2,4,6-trinitrobenzene-1,3-diol
5-[2-(4-hydroxyphenyl)ethenyl]-2,4,6-trinitrobenzene-1,3-diol (PubChem CID 172676316) has the molecular formula C14H9N3O9
and a molecular weight of 363.24 g/mol. Its IUPAC name is 5-[2-(4-hydroxyphenyl)ethenyl]-2,4,6-trinitrobenzene-1,3-diol.
Molecular Properties
| Compound Name | 5-[2-(4-hydroxyphenyl)ethenyl]-2,4,6-trinitrobenzene-1,3-diol |
| PubChem CID | 172676316 |
| Molecular Formula | C14H9N3O9 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 5-[2-(4-hydroxyphenyl)ethenyl]-2,4,6-trinitrobenzene-1,3-diol |
| SMILES | O=[N+]([O-])c1c(O)c([N+](=O)[O-])c(C=Cc2ccc(O)cc2)c([N+](=O)[O-])c1O |
| InChI | InChI=1S/C14H9N3O9/c18-8-4-1-7(2-5-8)3-6-9-10(15(21)22)13(19)12(17(25)26)14(20)11(9)16(23)24/h1-6,18-20H |
| InChIKey | WEDFDABLXGESQW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 190.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(4-hydroxyphenyl)ethenyl]-2,4,6-trinitrobenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4-hydroxyphenyl)ethenyl]-2,4,6-trinitrobenzene-1,3-diol?
The IUPAC name of 5-[2-(4-hydroxyphenyl)ethenyl]-2,4,6-trinitrobenzene-1,3-diol (CID 172676316) is 5-[2-(4-hydroxyphenyl)ethenyl]-2,4,6-trinitrobenzene-1,3-diol.
What is the SMILES notation for 5-[2-(4-hydroxyphenyl)ethenyl]-2,4,6-trinitrobenzene-1,3-diol?
The canonical SMILES for 5-[2-(4-hydroxyphenyl)ethenyl]-2,4,6-trinitrobenzene-1,3-diol is O=[N+]([O-])c1c(O)c([N+](=O)[O-])c(C=Cc2ccc(O)cc2)c([N+](=O)[O-])c1O.
What is the InChIKey of 5-[2-(4-hydroxyphenyl)ethenyl]-2,4,6-trinitrobenzene-1,3-diol?
The InChIKey is WEDFDABLXGESQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O9/c18-8-4-1-7(2-5-8)3-6-9-10(15(21)22)13(19)12(17(25)26)14(20)11(9)16(23)24/h1-6,18-20H.
What are the key properties of 5-[2-(4-hydroxyphenyl)ethenyl]-2,4,6-trinitrobenzene-1,3-diol?
5-[2-(4-hydroxyphenyl)ethenyl]-2,4,6-trinitrobenzene-1,3-diol has a molecular weight of 363.24 g/mol, XLogP of 2.70, 5 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4-hydroxyphenyl)ethenyl]-2,4,6-trinitrobenzene-1,3-diol is sourced from PubChem (CID 172676316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).