C14H11NO5 — CID 148920501
5-[2-(4-hydroxyphenyl)ethenyl]-4-nitrobenzene-1,3-diol (PubChem CID 148920501) has the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. Its IUPAC name is 5-[2-(4-hydroxyphenyl)ethenyl]-4-nitrobenzene-1,3-diol.
| Compound Name | 5-[2-(4-hydroxyphenyl)ethenyl]-4-nitrobenzene-1,3-diol |
|---|---|
| PubChem CID | 148920501 |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 5-[2-(4-hydroxyphenyl)ethenyl]-4-nitrobenzene-1,3-diol |
| SMILES | O=[N+]([O-])c1c(O)cc(O)cc1C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C14H11NO5/c16-11-5-2-9(3-6-11)1-4-10-7-12(17)8-13(18)14(10)15(19)20/h1-8,16-18H |
| InChIKey | NLHOBSNHPBTGGK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|