C28H24O6 — CID 68846116
3-[(E)-2-(2-hydroxyphenyl)ethenyl]benzene-1,2-diol;5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol (PubChem CID 68846116) has the molecular formula C28H24O6 and a molecular weight of 456.49 g/mol. Its IUPAC name is 3-[(E)-2-(2-hydroxyphenyl)ethenyl]benzene-1,2-diol;5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol.
| Compound Name | 3-[(E)-2-(2-hydroxyphenyl)ethenyl]benzene-1,2-diol;5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 68846116 |
| Molecular Formula | C28H24O6 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-[(E)-2-(2-hydroxyphenyl)ethenyl]benzene-1,2-diol;5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| SMILES | Oc1ccc(/C=C/c2cc(O)cc(O)c2)cc1.Oc1ccccc1/C=C/c1cccc(O)c1O |
| InChI | InChI=1S/2C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11;15-12-6-2-1-4-10(12)8-9-11-5-3-7-13(16)14(11)17/h2*1-9,15-17H/b2-1+;9-8+ |
| InChIKey | GDLJQTZGEYLTNP-NSDQYXPYSA-N |
| XLogP | 5.95 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|