C22H31N5O6S — CID 162675405
6-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]hexyl 4-oxo-4-(2-pyrrolidin-1-ylethylamino)butanoate (PubChem CID 162675405) has the molecular formula C22H31N5O6S and a molecular weight of 493.59 g/mol. Its IUPAC name is 6-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]hexyl 4-oxo-4-(2-pyrrolidin-1-ylethylamino)butanoate.
| Compound Name | 6-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]hexyl 4-oxo-4-(2-pyrrolidin-1-ylethylamino)butanoate |
|---|---|
| PubChem CID | 162675405 |
| Molecular Formula | C22H31N5O6S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 6-[(7-nitro-2,1,3-benzoxadiazol-4-yl)sulfanyl]hexyl 4-oxo-4-(2-pyrrolidin-1-ylethylamino)butanoate |
| SMILES | O=C(CCC(=O)OCCCCCCSc1ccc([N+](=O)[O-])c2nonc12)NCCN1CCCC1 |
| InChI | InChI=1S/C22H31N5O6S/c28-19(23-11-14-26-12-3-4-13-26)9-10-20(29)32-15-5-1-2-6-16-34-18-8-7-17(27(30)31)21-22(18)25-33-24-21/h7-8H,1-6,9-16H2,(H,23,28) |
| InChIKey | UFHFXVAGMNQCFF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|