C31H43N7O9 — CID 44634140
N-(2-morpholin-4-ylethyl)-3-[3-[2-[3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propylamino]-2-oxoethyl]spiro[1,2,4-trioxolane-5,2'-adamantane]-3-yl]propanamide (PubChem CID 44634140) has the molecular formula C31H43N7O9 and a molecular weight of 657.73 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-3-[3-[2-[3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propylamino]-2-oxoethyl]spiro[1,2,4-trioxolane-5,2'-adamantane]-3-yl]propanamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-3-[3-[2-[3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propylamino]-2-oxoethyl]spiro[1,2,4-trioxolane-5,2'-adamantane]-3-yl]propanamide |
|---|---|
| PubChem CID | 44634140 |
| Molecular Formula | C31H43N7O9 |
| Molecular Weight | 657.73 g/mol |
| Exact Mass | 657.31 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-3-[3-[2-[3-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]propylamino]-2-oxoethyl]spiro[1,2,4-trioxolane-5,2'-adamantane]-3-yl]propanamide |
| SMILES | O=C(CCC1(CC(=O)NCCCNc2ccc([N+](=O)[O-])c3nonc23)OOC2(O1)C1CC3CC(C1)CC2C3)NCCN1CCOCC1 |
| InChI | InChI=1S/C31H43N7O9/c39-26(34-8-9-37-10-12-43-13-11-37)4-5-30(44-31(46-45-30)22-15-20-14-21(17-22)18-23(31)16-20)19-27(40)33-7-1-6-32-24-2-3-25(38(41)42)29-28(24)35-47-36-29/h2-3,20-23,32H,1,4-19H2,(H,33,40)(H,34,39) |
| InChIKey | WUYQXKOPBMKNCQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 192.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.73 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|