C23H38N2O6 — CID 143931059
3-[3',7'-dimethyl-3-(2-oxoethyl)spiro[1,2,4-trioxolane-5,2'-bicyclo[3.3.1]nonane]-3-yl]-N-(2-morpholin-4-ylethyl)propanamide (PubChem CID 143931059) has the molecular formula C23H38N2O6 and a molecular weight of 438.57 g/mol. Its IUPAC name is 3-[3',7'-dimethyl-3-(2-oxoethyl)spiro[1,2,4-trioxolane-5,2'-bicyclo[3.3.1]nonane]-3-yl]-N-(2-morpholin-4-ylethyl)propanamide.
| Compound Name | 3-[3',7'-dimethyl-3-(2-oxoethyl)spiro[1,2,4-trioxolane-5,2'-bicyclo[3.3.1]nonane]-3-yl]-N-(2-morpholin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 143931059 |
| Molecular Formula | C23H38N2O6 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 3-[3',7'-dimethyl-3-(2-oxoethyl)spiro[1,2,4-trioxolane-5,2'-bicyclo[3.3.1]nonane]-3-yl]-N-(2-morpholin-4-ylethyl)propanamide |
| SMILES | CC1CC2CC(C)C3(OOC(CC=O)(CCC(=O)NCCN4CCOCC4)O3)C(C1)C2 |
| InChI | InChI=1S/C23H38N2O6/c1-17-13-19-15-18(2)23(20(14-17)16-19)29-22(5-10-26,30-31-23)4-3-21(27)24-6-7-25-8-11-28-12-9-25/h10,17-20H,3-9,11-16H2,1-2H3,(H,24,27) |
| InChIKey | XQFDQHZMQLOXJI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|